C7H9NS — CID 151356754
3,4-dimethylthiazepine (PubChem CID 151356754) has the molecular formula C7H9NS and a molecular weight of 139.22 g/mol. Its IUPAC name is 3,4-dimethylthiazepine.
| Compound Name | 3,4-dimethylthiazepine |
|---|---|
| PubChem CID | 151356754 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 3,4-dimethylthiazepine |
| SMILES | CC1=CC=CSN=C1C |
| InChI | InChI=1S/C7H9NS/c1-6-4-3-5-9-8-7(6)2/h3-5H,1-2H3 |
| InChIKey | ONQCPHSSFZEEDU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|