C18H40O3Si4 — CID 151496640
[4-(1,3,4,4,5,5,6-heptamethyl-6-silyloxycyclohex-2-en-1-yl)-3,4-disilyloxybut-3-enyl]-methylsilane (PubChem CID 151496640) has the molecular formula C18H40O3Si4 and a molecular weight of 416.86 g/mol. Its IUPAC name is [4-(1,3,4,4,5,5,6-heptamethyl-6-silyloxycyclohex-2-en-1-yl)-3,4-disilyloxybut-3-enyl]-methylsilane.
| Compound Name | [4-(1,3,4,4,5,5,6-heptamethyl-6-silyloxycyclohex-2-en-1-yl)-3,4-disilyloxybut-3-enyl]-methylsilane |
|---|---|
| PubChem CID | 151496640 |
| Molecular Formula | C18H40O3Si4 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [4-(1,3,4,4,5,5,6-heptamethyl-6-silyloxycyclohex-2-en-1-yl)-3,4-disilyloxybut-3-enyl]-methylsilane |
| SMILES | C[SiH2]CCC(O[SiH3])=C(O[SiH3])C1(C)C=C(C)C(C)(C)C(C)(C)C1(C)O[SiH3] |
| InChI | InChI=1S/C18H40O3Si4/c1-12-11-17(6,14(20-23)13(19-22)9-10-25-8)18(7,21-24)16(4,5)15(12,2)3/h11H,9-10,25H2,1-8,22-24H3 |
| InChIKey | PPOCVHPRWNSDAO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|