C30H23BrN4O — CID 151499881
1-(13-bromo-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)-N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine (PubChem CID 151499881) has the molecular formula C30H23BrN4O and a molecular weight of 535.45 g/mol. Its IUPAC name is 1-(13-bromo-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)-N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine.
| Compound Name | 1-(13-bromo-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)-N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 151499881 |
| Molecular Formula | C30H23BrN4O |
| Molecular Weight | 535.45 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 1-(13-bromo-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)-N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine |
| SMILES | Cc1ccc2oc(-c3ccc(/N=C/c4ccc5c(c4)CN4CN5Cc5cc(Br)ccc54)cc3)nc2c1 |
| InChI | InChI=1S/C30H23BrN4O/c1-19-2-11-29-26(12-19)33-30(36-29)21-4-7-25(8-5-21)32-15-20-3-9-27-22(13-20)16-34-18-35(27)17-23-14-24(31)6-10-28(23)34/h2-15H,16-18H2,1H3/b32-15+ |
| InChIKey | PQESDOVIVSNUNM-VWJSQJICSA-N |
| XLogP | 7.61 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.45 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|