C7H7NO7 — CID 151631270
3,4,5-trihydroxy-5-nitrocyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 151631270) has the molecular formula C7H7NO7 and a molecular weight of 217.13 g/mol. Its IUPAC name is 3,4,5-trihydroxy-5-nitrocyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-5-nitrocyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 151631270 |
| Molecular Formula | C7H7NO7 |
| Molecular Weight | 217.13 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 3,4,5-trihydroxy-5-nitrocyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | O=C(O)C1=CC(O)=C(O)C(O)([N+](=O)[O-])C1 |
| InChI | InChI=1S/C7H7NO7/c9-4-1-3(6(11)12)2-7(13,5(4)10)8(14)15/h1,9-10,13H,2H2,(H,11,12) |
| InChIKey | QQOGDNLWZNWION-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.13 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|