C17H9NO5 — CID 151666236
1-nitro-12H-benzo[a]xanthene-9,10-dione (PubChem CID 151666236) has the molecular formula C17H9NO5 and a molecular weight of 307.26 g/mol. Its IUPAC name is 1-nitro-12H-benzo[a]xanthene-9,10-dione.
| Compound Name | 1-nitro-12H-benzo[a]xanthene-9,10-dione |
|---|---|
| PubChem CID | 151666236 |
| Molecular Formula | C17H9NO5 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-nitro-12H-benzo[a]xanthene-9,10-dione |
| SMILES | O=C1C=C2Cc3c(ccc4cccc([N+](=O)[O-])c34)OC2=CC1=O |
| InChI | InChI=1S/C17H9NO5/c19-13-7-10-6-11-15(23-16(10)8-14(13)20)5-4-9-2-1-3-12(17(9)11)18(21)22/h1-5,7-8H,6H2 |
| InChIKey | QXOXURJPOPOVCU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|