C8H8O — CID 151694541
7,7a-dihydrocyclopenta[b]pyran (PubChem CID 151694541) has the molecular formula C8H8O and a molecular weight of 120.15 g/mol. Its IUPAC name is 7,7a-dihydrocyclopenta[b]pyran.
| Compound Name | 7,7a-dihydrocyclopenta[b]pyran |
|---|---|
| PubChem CID | 151694541 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 7,7a-dihydrocyclopenta[b]pyran |
| SMILES | C1=COC2CC=CC2=C1 |
| InChI | InChI=1S/C8H8O/c1-3-7-4-2-6-9-8(7)5-1/h1-4,6,8H,5H2 |
| InChIKey | RDGTZHYAZCFQTB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |