C11H9Cl2F3 — CID 151791954
1,3-dichloro-5-(4,4-difluoropent-1-en-3-yl)-2-fluorobenzene (PubChem CID 151791954) has the molecular formula C11H9Cl2F3 and a molecular weight of 269.09 g/mol. Its IUPAC name is 1,3-dichloro-5-(4,4-difluoropent-1-en-3-yl)-2-fluorobenzene.
| Compound Name | 1,3-dichloro-5-(4,4-difluoropent-1-en-3-yl)-2-fluorobenzene |
|---|---|
| PubChem CID | 151791954 |
| Molecular Formula | C11H9Cl2F3 |
| Molecular Weight | 269.09 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 1,3-dichloro-5-(4,4-difluoropent-1-en-3-yl)-2-fluorobenzene |
| SMILES | C=CC(c1cc(Cl)c(F)c(Cl)c1)C(C)(F)F |
| InChI | InChI=1S/C11H9Cl2F3/c1-3-7(11(2,15)16)6-4-8(12)10(14)9(13)5-6/h3-5,7H,1H2,2H3 |
| InChIKey | RWUOJIOVTBPFLQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.09 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|