C7H9N5O3 — CID 1519141
N-cyclopropyl-2-(3-nitro-1H-1,2,4-triazol-1-yl)acetamide (PubChem CID 1519141) has the molecular formula C7H9N5O3 and a molecular weight of 211.18 g/mol. Its IUPAC name is N-cyclopropyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-cyclopropyl-2-(3-nitro-1H-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 1519141 |
| Molecular Formula | C7H9N5O3 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | N-cyclopropyl-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | C1CC1NC(=O)CN2C=NC(=N2)[N+](=O)[O-] |
| InChI | InChI=1S/C7H9N5O3/c13-6(9-5-1-2-5)3-11-4-8-7(10-11)12(14)15/h4-5H,1-3H2,(H,9,13) |
| InChIKey | AKSADRHJFBOBBF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | 274 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|