C11H7F7O2 — CID 15194724
2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,5-dimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 15194724) has the molecular formula C11H7F7O2 and a molecular weight of 304.16 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,5-dimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,5-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15194724 |
| Molecular Formula | C11H7F7O2 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3,5-dimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(C(F)(F)C(F)(F)C(F)(F)F)=C(C)C1=O |
| InChI | InChI=1S/C11H7F7O2/c1-4-3-6(19)7(5(2)8(4)20)9(12,13)10(14,15)11(16,17)18/h3H,1-2H3 |
| InChIKey | CTKGGYBINVJJAY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|