C16H29NO3SSi — CID 15236868
(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-3-oxothian-2-yl]azetidin-2-one (PubChem CID 15236868) has the molecular formula C16H29NO3SSi and a molecular weight of 343.57 g/mol. Its IUPAC name is (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-3-oxothian-2-yl]azetidin-2-one.
| Compound Name | (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-3-oxothian-2-yl]azetidin-2-one |
|---|---|
| PubChem CID | 15236868 |
| Molecular Formula | C16H29NO3SSi |
| Molecular Weight | 343.57 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-3-oxothian-2-yl]azetidin-2-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1[C@H]1SCCCC1=O |
| InChI | InChI=1S/C16H29NO3SSi/c1-10(20-22(5,6)16(2,3)4)12-13(17-15(12)19)14-11(18)8-7-9-21-14/h10,12-14H,7-9H2,1-6H3,(H,17,19)/t10-,12-,13+,14+/m1/s1 |
| InChIKey | IKWAOMMRSSNABT-ZZVYKPCYSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|