C8H9NO2 — CID 152618983
1-hydroxy-3,4-dihydro-2,1-benzoxazine (PubChem CID 152618983) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 1-hydroxy-3,4-dihydro-2,1-benzoxazine.
| Compound Name | 1-hydroxy-3,4-dihydro-2,1-benzoxazine |
|---|---|
| PubChem CID | 152618983 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 1-hydroxy-3,4-dihydro-2,1-benzoxazine |
| SMILES | ON1OCCc2ccccc21 |
| InChI | InChI=1S/C8H9NO2/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-4,10H,5-6H2 |
| InChIKey | ZBCUIUDWJQFEOO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |