C8H6F2N2O — CID 152634177
(2,6-difluorophenyl)methylideneurea (PubChem CID 152634177) has the molecular formula C8H6F2N2O and a molecular weight of 184.15 g/mol. Its IUPAC name is (2,6-difluorophenyl)methylideneurea.
| Compound Name | (2,6-difluorophenyl)methylideneurea |
|---|---|
| PubChem CID | 152634177 |
| Molecular Formula | C8H6F2N2O |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | (2,6-difluorophenyl)methylideneurea |
| SMILES | NC(=O)N=Cc1c(F)cccc1F |
| InChI | InChI=1S/C8H6F2N2O/c9-6-2-1-3-7(10)5(6)4-12-8(11)13/h1-4H,(H2,11,13) |
| InChIKey | ZEEFFUSUWCBOCT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|