C20H21ClF4O5 — CID 152779688
trans-[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl (1S,3S)-3-[(E)-2-chloro-3-oxo-3-propoxyprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 152779688) has the molecular formula C20H21ClF4O5 and a molecular weight of 452.83 g/mol. Its IUPAC name is trans-[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl (1S,3S)-3-[(E)-2-chloro-3-oxo-3-propoxyprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl (1S,3S)-3-[(E)-2-chloro-3-oxo-3-propoxyprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 152779688 |
| Molecular Formula | C20H21ClF4O5 |
| Molecular Weight | 452.83 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | trans-[2,3,5,6-tetrafluoro-4-(hydroxymethyl)phenyl]methyl (1S,3S)-3-[(E)-2-chloro-3-oxo-3-propoxyprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCCOC(=O)/C(Cl)=C\[C@@H]1[C@H](C(=O)OCc2c(F)c(F)c(CO)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C20H21ClF4O5/c1-4-5-29-18(27)12(21)6-11-13(20(11,2)3)19(28)30-8-10-16(24)14(22)9(7-26)15(23)17(10)25/h6,11,13,26H,4-5,7-8H2,1-3H3/b12-6+/t11-,13-/m1/s1 |
| InChIKey | ARSZIMMDKSTGNA-URFGDBDFSA-N |
| XLogP | 4.13 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|