C24H33N5O3S2 — CID 152882807
5,19-dimethyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3-thia-7,10,14,20,21-pentazatricyclo[14.3.1.12,5]henicosa-1(19),2(21),16(20),17-tetraene-6,9,13-trione (PubChem CID 152882807) has the molecular formula C24H33N5O3S2 and a molecular weight of 503.69 g/mol. Its IUPAC name is 5,19-dimethyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3-thia-7,10,14,20,21-pentazatricyclo[14.3.1.12,5]henicosa-1(19),2(21),16(20),17-tetraene-6,9,13-trione.
| Compound Name | 5,19-dimethyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3-thia-7,10,14,20,21-pentazatricyclo[14.3.1.12,5]henicosa-1(19),2(21),16(20),17-tetraene-6,9,13-trione |
|---|---|
| PubChem CID | 152882807 |
| Molecular Formula | C24H33N5O3S2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 5,19-dimethyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3-thia-7,10,14,20,21-pentazatricyclo[14.3.1.12,5]henicosa-1(19),2(21),16(20),17-tetraene-6,9,13-trione |
| SMILES | Cc1ccc2nc1C1=NC(C)(CS1)C(=O)NC(C(C)C)C(=O)NC(/C=C/CCS)CC(=O)NC2 |
| InChI | InChI=1S/C24H33N5O3S2/c1-14(2)19-21(31)27-16(7-5-6-10-33)11-18(30)25-12-17-9-8-15(3)20(26-17)22-29-24(4,13-34-22)23(32)28-19/h5,7-9,14,16,19,33H,6,10-13H2,1-4H3,(H,25,30)(H,27,31)(H,28,32)/b7-5+ |
| InChIKey | UBURYZURZISZGW-FNORWQNLSA-N |
| XLogP | 2.16 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|