C24H18O2S — CID 15330239
1,3-diphenyl-2-(3-phenylsulfanylprop-2-ynyl)propane-1,3-dione (PubChem CID 15330239) has the molecular formula C24H18O2S and a molecular weight of 370.47 g/mol. Its IUPAC name is 1,3-diphenyl-2-(3-phenylsulfanylprop-2-ynyl)propane-1,3-dione.
| Compound Name | 1,3-diphenyl-2-(3-phenylsulfanylprop-2-ynyl)propane-1,3-dione |
|---|---|
| PubChem CID | 15330239 |
| Molecular Formula | C24H18O2S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1,3-diphenyl-2-(3-phenylsulfanylprop-2-ynyl)propane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(CC#CSc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H18O2S/c25-23(19-11-4-1-5-12-19)22(24(26)20-13-6-2-7-14-20)17-10-18-27-21-15-8-3-9-16-21/h1-9,11-16,22H,17H2 |
| InChIKey | AGBJDIFKSQDGFS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|