C11H9Cl2F2N — CID 153306171
4,4-dichloro-1,6-difluoro-3,3-dimethylisoquinoline (PubChem CID 153306171) has the molecular formula C11H9Cl2F2N and a molecular weight of 264.10 g/mol. Its IUPAC name is 4,4-dichloro-1,6-difluoro-3,3-dimethylisoquinoline.
| Compound Name | 4,4-dichloro-1,6-difluoro-3,3-dimethylisoquinoline |
|---|---|
| PubChem CID | 153306171 |
| Molecular Formula | C11H9Cl2F2N |
| Molecular Weight | 264.10 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 4,4-dichloro-1,6-difluoro-3,3-dimethylisoquinoline |
| SMILES | CC1(C)N=C(F)c2ccc(F)cc2C1(Cl)Cl |
| InChI | InChI=1S/C11H9Cl2F2N/c1-10(2)11(12,13)8-5-6(14)3-4-7(8)9(15)16-10/h3-5H,1-2H3 |
| InChIKey | DFQLAFROEQNALC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.10 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|