C12H11ClFN — CID 123775597
2-chloro-7-fluoro-5,5-dimethyl-1-benzazepine (PubChem CID 123775597) has the molecular formula C12H11ClFN and a molecular weight of 223.68 g/mol. Its IUPAC name is 2-chloro-7-fluoro-5,5-dimethyl-1-benzazepine.
| Compound Name | 2-chloro-7-fluoro-5,5-dimethyl-1-benzazepine |
|---|---|
| PubChem CID | 123775597 |
| Molecular Formula | C12H11ClFN |
| Molecular Weight | 223.68 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-chloro-7-fluoro-5,5-dimethyl-1-benzazepine |
| SMILES | CC1(C)C=CC(Cl)=Nc2ccc(F)cc21 |
| InChI | InChI=1S/C12H11ClFN/c1-12(2)6-5-11(13)15-10-4-3-8(14)7-9(10)12/h3-7H,1-2H3 |
| InChIKey | ADTNWNXWJRPSFH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.68 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |