C8H8BrF3MgOSi — CID 153323692
magnesium;dimethyl-oxido-(2,3,4-trifluorophenyl)silane;bromide (PubChem CID 153323692) has the molecular formula C8H8BrF3MgOSi and a molecular weight of 309.44 g/mol. Its IUPAC name is magnesium;dimethyl-oxido-(2,3,4-trifluorophenyl)silane;bromide.
| Compound Name | magnesium;dimethyl-oxido-(2,3,4-trifluorophenyl)silane;bromide |
|---|---|
| PubChem CID | 153323692 |
| Molecular Formula | C8H8BrF3MgOSi |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | magnesium;dimethyl-oxido-(2,3,4-trifluorophenyl)silane;bromide |
| SMILES | C[Si](C)([O-])c1ccc(F)c(F)c1F.[Br-].[Mg+2] |
| InChI | InChI=1S/C8H8F3OSi.BrH.Mg/c1-13(2,12)6-4-3-5(9)7(10)8(6)11;;/h3-4H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | RWEVPLPAIHCEMC-UHFFFAOYSA-M |
| XLogP | -2.50 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|