C21H35BFN3O4 — CID 153337166
tert-butyl 2-fluoro-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborepan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 153337166) has the molecular formula C21H35BFN3O4 and a molecular weight of 423.34 g/mol. Its IUPAC name is tert-butyl 2-fluoro-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborepan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-fluoro-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborepan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 153337166 |
| Molecular Formula | C21H35BFN3O4 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | tert-butyl 2-fluoro-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborepan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(B3OCCC(C)(C)C(C)(C)O3)cn2)CC1F |
| InChI | InChI=1S/C21H35BFN3O4/c1-19(2,3)29-18(27)25-10-8-16(12-17(25)23)26-14-15(13-24-26)22-28-11-9-20(4,5)21(6,7)30-22/h13-14,16-17H,8-12H2,1-7H3 |
| InChIKey | ADDKDOCJNGOZFI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|