C11H17NS — CID 153344229
N-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpropanethioamide (PubChem CID 153344229) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is N-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpropanethioamide.
| Compound Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 153344229 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methylpropanethioamide |
| SMILES | C=C/C=C(\C=C)CNC(=S)C(C)C |
| InChI | InChI=1S/C11H17NS/c1-5-7-10(6-2)8-12-11(13)9(3)4/h5-7,9H,1-2,8H2,3-4H3,(H,12,13)/b10-7+ |
| InChIKey | SBRARODZWWMIQK-JXMROGBWSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|