C12H22N2S — CID 145170272
(2E)-2-ethenyl-N-methylpenta-2,4-dien-1-amine;N-propylmethanethioamide (PubChem CID 145170272) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is (2E)-2-ethenyl-N-methylpenta-2,4-dien-1-amine;N-propylmethanethioamide.
| Compound Name | (2E)-2-ethenyl-N-methylpenta-2,4-dien-1-amine;N-propylmethanethioamide |
|---|---|
| PubChem CID | 145170272 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (2E)-2-ethenyl-N-methylpenta-2,4-dien-1-amine;N-propylmethanethioamide |
| SMILES | C=C/C=C(\C=C)CNC.CCCNC=S |
| InChI | InChI=1S/C8H13N.C4H9NS/c1-4-6-8(5-2)7-9-3;1-2-3-5-4-6/h4-6,9H,1-2,7H2,3H3;4H,2-3H2,1H3,(H,5,6)/b8-6+; |
| InChIKey | INGOLPDSUKONNB-WVLIHFOGSA-N |
| XLogP | 2.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|