C17H35N3O5 — CID 153354034
propyl 3-[2-(6-aminohexylcarbamoyloxy)ethyl-(2-hydroxyethyl)amino]propanoate (PubChem CID 153354034) has the molecular formula C17H35N3O5 and a molecular weight of 361.48 g/mol. Its IUPAC name is propyl 3-[2-(6-aminohexylcarbamoyloxy)ethyl-(2-hydroxyethyl)amino]propanoate.
| Compound Name | propyl 3-[2-(6-aminohexylcarbamoyloxy)ethyl-(2-hydroxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 153354034 |
| Molecular Formula | C17H35N3O5 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | propyl 3-[2-(6-aminohexylcarbamoyloxy)ethyl-(2-hydroxyethyl)amino]propanoate |
| SMILES | CCCOC(=O)CCN(CCO)CCOC(=O)NCCCCCCN |
| InChI | InChI=1S/C17H35N3O5/c1-2-14-24-16(22)7-10-20(11-13-21)12-15-25-17(23)19-9-6-4-3-5-8-18/h21H,2-15,18H2,1H3,(H,19,23) |
| InChIKey | FFDJXZYHYNDJIV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|