C26H38O3 — CID 153371334
(6aR,10aR)-6,6,6a-trimethyl-3-(2-methyloctan-2-yl)-10,10a-dihydro-7H-benzo[c]chromene-9-carboxylic acid (PubChem CID 153371334) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (6aR,10aR)-6,6,6a-trimethyl-3-(2-methyloctan-2-yl)-10,10a-dihydro-7H-benzo[c]chromene-9-carboxylic acid.
| Compound Name | (6aR,10aR)-6,6,6a-trimethyl-3-(2-methyloctan-2-yl)-10,10a-dihydro-7H-benzo[c]chromene-9-carboxylic acid |
|---|---|
| PubChem CID | 153371334 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (6aR,10aR)-6,6,6a-trimethyl-3-(2-methyloctan-2-yl)-10,10a-dihydro-7H-benzo[c]chromene-9-carboxylic acid |
| SMILES | CCCCCCC(C)(C)c1ccc2c(c1)OC(C)(C)[C@]1(C)CC=C(C(=O)O)C[C@@H]21 |
| InChI | InChI=1S/C26H38O3/c1-7-8-9-10-14-24(2,3)19-11-12-20-21-16-18(23(27)28)13-15-26(21,6)25(4,5)29-22(20)17-19/h11-13,17,21H,7-10,14-16H2,1-6H3,(H,27,28)/t21-,26+/m0/s1 |
| InChIKey | CRCIRMPLFQUODT-HFZDXXHNSA-N |
| XLogP | 7.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|