C6H13NS — CID 153380610
3,5-dimethylthiazinane (PubChem CID 153380610) has the molecular formula C6H13NS and a molecular weight of 131.24 g/mol. Its IUPAC name is 3,5-dimethylthiazinane.
| Compound Name | 3,5-dimethylthiazinane |
|---|---|
| PubChem CID | 153380610 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | 3,5-dimethylthiazinane |
| SMILES | CC1CSNC(C)C1 |
| InChI | InChI=1S/C6H13NS/c1-5-3-6(2)7-8-4-5/h5-7H,3-4H2,1-2H3 |
| InChIKey | UPSXLPZIRMEIGV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|