C21H23NOS2 — CID 153391802
ethane;S-(indole-1-carbothioyl) 2,4,6-trimethylbenzenecarbothioate (PubChem CID 153391802) has the molecular formula C21H23NOS2 and a molecular weight of 369.56 g/mol. Its IUPAC name is ethane;S-(indole-1-carbothioyl) 2,4,6-trimethylbenzenecarbothioate.
| Compound Name | ethane;S-(indole-1-carbothioyl) 2,4,6-trimethylbenzenecarbothioate |
|---|---|
| PubChem CID | 153391802 |
| Molecular Formula | C21H23NOS2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | ethane;S-(indole-1-carbothioyl) 2,4,6-trimethylbenzenecarbothioate |
| SMILES | CC.Cc1cc(C)c(C(=O)SC(=S)n2ccc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C19H17NOS2.C2H6/c1-12-10-13(2)17(14(3)11-12)18(21)23-19(22)20-9-8-15-6-4-5-7-16(15)20;1-2/h4-11H,1-3H3;1-2H3 |
| InChIKey | QLGSPTZIUYLIGY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|