C21H32ClN7OS — CID 153396586
6-chloro-2-(3,4-diethylpiperazin-1-yl)-N-(2-morpholin-4-ylsulfanylethyl)pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 153396586) has the molecular formula C21H32ClN7OS and a molecular weight of 466.06 g/mol. Its IUPAC name is 6-chloro-2-(3,4-diethylpiperazin-1-yl)-N-(2-morpholin-4-ylsulfanylethyl)pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-(3,4-diethylpiperazin-1-yl)-N-(2-morpholin-4-ylsulfanylethyl)pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 153396586 |
| Molecular Formula | C21H32ClN7OS |
| Molecular Weight | 466.06 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 6-chloro-2-(3,4-diethylpiperazin-1-yl)-N-(2-morpholin-4-ylsulfanylethyl)pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CCC1CN(c2nc(NCCSN3CCOCC3)c3cc(Cl)ncc3n2)CCN1CC |
| InChI | InChI=1S/C21H32ClN7OS/c1-3-16-15-28(7-6-27(16)4-2)21-25-18-14-24-19(22)13-17(18)20(26-21)23-5-12-31-29-8-10-30-11-9-29/h13-14,16H,3-12,15H2,1-2H3,(H,23,25,26) |
| InChIKey | UIKIUKGIODXBRH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.06 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|