C17H33N3 — CID 153397405
ethene;(3E,5E)-N-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-3,5-dien-3-amine (PubChem CID 153397405) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is ethene;(3E,5E)-N-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-3,5-dien-3-amine.
| Compound Name | ethene;(3E,5E)-N-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 153397405 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | ethene;(3E,5E)-N-methyl-5-(4-methyl-1,4-diazepan-1-yl)octa-3,5-dien-3-amine |
| SMILES | C=C.CC/C=C(\C=C(/CC)NC)N1CCCN(C)CC1 |
| InChI | InChI=1S/C15H29N3.C2H4/c1-5-8-15(13-14(6-2)16-3)18-10-7-9-17(4)11-12-18;1-2/h8,13,16H,5-7,9-12H2,1-4H3;1-2H2/b14-13+,15-8+; |
| InChIKey | WACCBRVUJQAPSH-SYGGMRGNSA-N |
| XLogP | 3.23 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|