C25H30N2O4 — CID 153398840
(10-butanoyloxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 4-aminobutanoate (PubChem CID 153398840) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is (10-butanoyloxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 4-aminobutanoate.
| Compound Name | (10-butanoyloxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 4-aminobutanoate |
|---|---|
| PubChem CID | 153398840 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (10-butanoyloxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 4-aminobutanoate |
| SMILES | CCCC(=O)Oc1ccc2c(c1OC(=O)CCCN)-c1cccc3c1C(C2)N(C)CC3 |
| InChI | InChI=1S/C25H30N2O4/c1-3-6-21(28)30-20-11-10-17-15-19-23-16(12-14-27(19)2)7-4-8-18(23)24(17)25(20)31-22(29)9-5-13-26/h4,7-8,10-11,19H,3,5-6,9,12-15,26H2,1-2H3 |
| InChIKey | RVVBHWDRYNPBOL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|