About CID 153445903
CID 153445903 (PubChem CID 153445903) has the molecular formula C5H3NO2Si
and a molecular weight of 137.17 g/mol.
Molecular Properties
| Compound Name | CID 153445903 |
| PubChem CID | 153445903 |
| Molecular Formula | C5H3NO2Si |
| Molecular Weight | 137.17 g/mol |
| Exact Mass | 136.99 |
| IUPAC Name | — |
| SMILES | c1cc2c(cn1)O[Si]O2 |
| InChI | InChI=1S/C5H3NO2Si/c1-2-6-3-5-4(1)7-9-8-5/h1-3H |
| InChIKey | GPIDOIFDIPIEKB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.17 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153445903 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153445903?
The IUPAC name of CID 153445903 (CID 153445903) is not available.
What is the SMILES notation for CID 153445903?
The canonical SMILES for CID 153445903 is c1cc2c(cn1)O[Si]O2.
What is the InChIKey of CID 153445903?
The InChIKey is GPIDOIFDIPIEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3NO2Si/c1-2-6-3-5-4(1)7-9-8-5/h1-3H.
What are the key properties of CID 153445903?
CID 153445903 has a molecular weight of 137.17 g/mol, XLogP of 0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153445903 is sourced from PubChem (CID 153445903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).