C8H6N2O — CID 70352811
pyrido[4,3-f][1,4]oxazepine (PubChem CID 70352811) has the molecular formula C8H6N2O and a molecular weight of 146.15 g/mol. Its IUPAC name is pyrido[4,3-f][1,4]oxazepine.
| Compound Name | pyrido[4,3-f][1,4]oxazepine |
|---|---|
| PubChem CID | 70352811 |
| Molecular Formula | C8H6N2O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | pyrido[4,3-f][1,4]oxazepine |
| SMILES | C1=COc2cnccc2C=N1 |
| InChI | InChI=1S/C8H6N2O/c1-2-9-6-8-7(1)5-10-3-4-11-8/h1-6H |
| InChIKey | KTSOHMXHVGZAPO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |