C8H12BrN2O2+ — CID 153483683
ethyl 2-bromo-3,4-dimethyl-1H-imidazol-3-ium-5-carboxylate (PubChem CID 153483683) has the molecular formula C8H12BrN2O2+ and a molecular weight of 248.10 g/mol. Its IUPAC name is ethyl 2-bromo-3,4-dimethyl-1H-imidazol-3-ium-5-carboxylate.
| Compound Name | ethyl 2-bromo-3,4-dimethyl-1H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 153483683 |
| Molecular Formula | C8H12BrN2O2+ |
| Molecular Weight | 248.10 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | ethyl 2-bromo-3,4-dimethyl-1H-imidazol-3-ium-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(Br)[n+](C)c1C |
| InChI | InChI=1S/C8H11BrN2O2/c1-4-13-7(12)6-5(2)11(3)8(9)10-6/h4H2,1-3H3/p+1 |
| InChIKey | MBPPCVWOILHKML-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.10 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|