C43H75NO4 — CID 153487289
(6Z,9Z,28Z,31Z)-19-[1-(1,3-dioxolan-4-yl)ethyl-methylamino]heptatriaconta-6,9,28,31-tetraene-18,20-dione (PubChem CID 153487289) has the molecular formula C43H75NO4 and a molecular weight of 670.08 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-19-[1-(1,3-dioxolan-4-yl)ethyl-methylamino]heptatriaconta-6,9,28,31-tetraene-18,20-dione.
| Compound Name | (6Z,9Z,28Z,31Z)-19-[1-(1,3-dioxolan-4-yl)ethyl-methylamino]heptatriaconta-6,9,28,31-tetraene-18,20-dione |
|---|---|
| PubChem CID | 153487289 |
| Molecular Formula | C43H75NO4 |
| Molecular Weight | 670.08 g/mol |
| Exact Mass | 669.57 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-19-[1-(1,3-dioxolan-4-yl)ethyl-methylamino]heptatriaconta-6,9,28,31-tetraene-18,20-dione |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)C(C(=O)CCCCCCC/C=C\C/C=C\CCCCC)N(C)C(C)C1COCO1 |
| InChI | InChI=1S/C43H75NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40(45)43(44(4)39(3)42-37-47-38-48-42)41(46)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,39,42-43H,5-12,17-18,23-38H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | VSRAUVQKRPAAEX-KWXKLSQISA-N |
| XLogP | 11.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.08 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|