C29H30N2O5 — CID 15384842
methyl (3aR,4S,11bS)-4,7,10-triacetyl-3-benzyl-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-d]carbazole-6-carboxylate (PubChem CID 15384842) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is methyl (3aR,4S,11bS)-4,7,10-triacetyl-3-benzyl-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-d]carbazole-6-carboxylate.
| Compound Name | methyl (3aR,4S,11bS)-4,7,10-triacetyl-3-benzyl-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-d]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 15384842 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | methyl (3aR,4S,11bS)-4,7,10-triacetyl-3-benzyl-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-d]carbazole-6-carboxylate |
| SMILES | COC(=O)C1=C2N(C(C)=O)c3ccc(C(C)=O)cc3[C@]23CCN(Cc2ccccc2)[C@@H]3[C@@H](C(C)=O)C1 |
| InChI | InChI=1S/C29H30N2O5/c1-17(32)21-10-11-25-24(14-21)29-12-13-30(16-20-8-6-5-7-9-20)26(29)22(18(2)33)15-23(28(35)36-4)27(29)31(25)19(3)34/h5-11,14,22,26H,12-13,15-16H2,1-4H3/t22-,26-,29+/m1/s1 |
| InChIKey | ZEZLBVBOZSVMTN-DPOVLBOKSA-N |
| XLogP | 3.80 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |