C13H10F2N2 — CID 15387978
N,N'-bis(2-fluorophenyl)methanimidamide (PubChem CID 15387978) has the molecular formula C13H10F2N2 and a molecular weight of 232.23 g/mol. Its IUPAC name is N,N'-bis(2-fluorophenyl)methanimidamide.
| Compound Name | N,N'-bis(2-fluorophenyl)methanimidamide |
|---|---|
| PubChem CID | 15387978 |
| Molecular Formula | C13H10F2N2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N,N'-bis(2-fluorophenyl)methanimidamide |
| SMILES | Fc1ccccc1/N=C/Nc1ccccc1F |
| InChI | InChI=1S/C13H10F2N2/c14-10-5-1-3-7-12(10)16-9-17-13-8-4-2-6-11(13)15/h1-9H,(H,16,17) |
| InChIKey | NJAIFUHESHECHG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|