C19H20F6N4 — CID 154009204
(5S)-5-[1-(2,2,2-trifluoroethyl)-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine (PubChem CID 154009204) has the molecular formula C19H20F6N4 and a molecular weight of 418.39 g/mol. Its IUPAC name is (5S)-5-[1-(2,2,2-trifluoroethyl)-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine.
| Compound Name | (5S)-5-[1-(2,2,2-trifluoroethyl)-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 154009204 |
| Molecular Formula | C19H20F6N4 |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (5S)-5-[1-(2,2,2-trifluoroethyl)-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
| SMILES | NC1C[C@@H](N2Cc3cnn(CC(F)(F)F)c3C2)CCC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H20F6N4/c20-14-5-16(22)15(21)4-13(14)12-2-1-11(3-17(12)26)28-7-10-6-27-29(18(10)8-28)9-19(23,24)25/h4-6,11-12,17H,1-3,7-9,26H2/t11-,12?,17?/m0/s1 |
| InChIKey | ZEYWEGYFTZSJAB-DLGFLZQMSA-N |
| XLogP | 3.84 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|