C19H19F3N6 — CID 143674548
(1S)-5-(4,7,8,9,12-pentazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine (PubChem CID 143674548) has the molecular formula C19H19F3N6 and a molecular weight of 388.40 g/mol. Its IUPAC name is (1S)-5-(4,7,8,9,12-pentazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine.
| Compound Name | (1S)-5-(4,7,8,9,12-pentazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 143674548 |
| Molecular Formula | C19H19F3N6 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (1S)-5-(4,7,8,9,12-pentazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
| SMILES | N[C@H]1CC(N2Cc3nn4nccnc4c3C2)CCC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H19F3N6/c20-14-7-16(22)15(21)6-12(14)11-2-1-10(5-17(11)23)27-8-13-18(9-27)26-28-19(13)24-3-4-25-28/h3-4,6-7,10-11,17H,1-2,5,8-9,23H2/t10?,11?,17-/m0/s1 |
| InChIKey | LOJYEZVRMNVDOU-IGCAFJPESA-N |
| XLogP | 2.52 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|