C6H12N2O2S — CID 154013602
3-sulfonylcyclohexane-1,2-diamine (PubChem CID 154013602) has the molecular formula C6H12N2O2S and a molecular weight of 176.24 g/mol. Its IUPAC name is 3-sulfonylcyclohexane-1,2-diamine.
| Compound Name | 3-sulfonylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 154013602 |
| Molecular Formula | C6H12N2O2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3-sulfonylcyclohexane-1,2-diamine |
| SMILES | NC1CCCC(=S(=O)=O)C1N |
| InChI | InChI=1S/C6H12N2O2S/c7-4-2-1-3-5(6(4)8)11(9)10/h4,6H,1-3,7-8H2 |
| InChIKey | QYQFQIKCVFWOHS-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|