C26H42N4O8S2 — CID 154038889
3-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylimino]propyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyheptyl]cyclopentyl]hept-5-enoate (PubChem CID 154038889) has the molecular formula C26H42N4O8S2 and a molecular weight of 602.78 g/mol. Its IUPAC name is 3-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylimino]propyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyheptyl]cyclopentyl]hept-5-enoate.
| Compound Name | 3-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylimino]propyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyheptyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 154038889 |
| Molecular Formula | C26H42N4O8S2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 3-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfonylimino]propyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-hydroxyheptyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCC[C@H](O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)OCCC=NS(=O)(=O)c2nnc(NC(C)=O)s2)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C26H42N4O8S2/c1-3-4-10-19(32)13-14-21-20(22(33)17-23(21)34)11-7-5-6-8-12-24(35)38-16-9-15-27-40(36,37)26-30-29-25(39-26)28-18(2)31/h5,7,15,19-23,32-34H,3-4,6,8-14,16-17H2,1-2H3,(H,28,29,31)/b7-5-,27-15?/t19-,20+,21+,22-,23+/m0/s1 |
| InChIKey | DZJIKDJMGREYOF-HKTSTIIASA-N |
| XLogP | 3.00 |
| TPSA | 188.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|