C20H16N2O6 — CID 154049255
1,3-dioxol-4-ylmethyl 3-benzyl-2,4-dioxo-1H-quinazoline-6-carboxylate (PubChem CID 154049255) has the molecular formula C20H16N2O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is 1,3-dioxol-4-ylmethyl 3-benzyl-2,4-dioxo-1H-quinazoline-6-carboxylate.
| Compound Name | 1,3-dioxol-4-ylmethyl 3-benzyl-2,4-dioxo-1H-quinazoline-6-carboxylate |
|---|---|
| PubChem CID | 154049255 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1,3-dioxol-4-ylmethyl 3-benzyl-2,4-dioxo-1H-quinazoline-6-carboxylate |
| SMILES | O=C(OCC1=COCO1)c1ccc2[nH]c(=O)n(Cc3ccccc3)c(=O)c2c1 |
| InChI | InChI=1S/C20H16N2O6/c23-18-16-8-14(19(24)27-11-15-10-26-12-28-15)6-7-17(16)21-20(25)22(18)9-13-4-2-1-3-5-13/h1-8,10H,9,11-12H2,(H,21,25) |
| InChIKey | JFGMBBCNPCUOAK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |