C14H22BNO5 — CID 154063548
2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazol-5-yl]ethyl acetate (PubChem CID 154063548) has the molecular formula C14H22BNO5 and a molecular weight of 295.14 g/mol. Its IUPAC name is 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazol-5-yl]ethyl acetate.
| Compound Name | 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazol-5-yl]ethyl acetate |
|---|---|
| PubChem CID | 154063548 |
| Molecular Formula | C14H22BNO5 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazol-5-yl]ethyl acetate |
| SMILES | CC(=O)OCCc1onc(C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H22BNO5/c1-9-12(11(19-16-9)7-8-18-10(2)17)15-20-13(3,4)14(5,6)21-15/h7-8H2,1-6H3 |
| InChIKey | LXHKMDPPKAVVPJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|