C29H36BNO14 — CID 154064855
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-5-methyl-6-[2-methyl-4-[2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)ethenyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 154064855) has the molecular formula C29H36BNO14 and a molecular weight of 633.41 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-5-methyl-6-[2-methyl-4-[2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)ethenyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-5-methyl-6-[2-methyl-4-[2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)ethenyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 154064855 |
| Molecular Formula | C29H36BNO14 |
| Molecular Weight | 633.41 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-5-methyl-6-[2-methyl-4-[2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)ethenyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Oc2ccc(C=CB3OC(=O)CN(C)CC(=O)O3)cc2C)[C@@](C)(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H36BNO14/c1-16-12-21(10-11-30-44-24(36)13-31(7)14-25(37)45-30)8-9-22(16)41-28-29(6,43-20(5)35)27(40-19(4)34)26(39-18(3)33)23(42-28)15-38-17(2)32/h8-12,23,26-28H,13-15H2,1-7H3/t23-,26-,27+,28+,29+/m1/s1 |
| InChIKey | VCAULWPIAHFJSP-BSNVCIOISA-N |
| XLogP | 0.92 |
| TPSA | 179.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|