C9H21NO2Si — CID 154083227
N-(3,3-dimethoxyprop-1-enylsilyl)-N-ethylethanamine (PubChem CID 154083227) has the molecular formula C9H21NO2Si and a molecular weight of 203.36 g/mol. Its IUPAC name is N-(3,3-dimethoxyprop-1-enylsilyl)-N-ethylethanamine.
| Compound Name | N-(3,3-dimethoxyprop-1-enylsilyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 154083227 |
| Molecular Formula | C9H21NO2Si |
| Molecular Weight | 203.36 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-(3,3-dimethoxyprop-1-enylsilyl)-N-ethylethanamine |
| SMILES | CCN(CC)[SiH2]C=CC(OC)OC |
| InChI | InChI=1S/C9H21NO2Si/c1-5-10(6-2)13-8-7-9(11-3)12-4/h7-9H,5-6,13H2,1-4H3 |
| InChIKey | KCSANPSOQUENRC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|