C17H15N3O7S — CID 154100150
2-[2-(5-nitrofuran-2-yl)pyrimidin-5-yl]oxyethyl 4-methylbenzenesulfonate (PubChem CID 154100150) has the molecular formula C17H15N3O7S and a molecular weight of 405.39 g/mol. Its IUPAC name is 2-[2-(5-nitrofuran-2-yl)pyrimidin-5-yl]oxyethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-(5-nitrofuran-2-yl)pyrimidin-5-yl]oxyethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154100150 |
| Molecular Formula | C17H15N3O7S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-[2-(5-nitrofuran-2-yl)pyrimidin-5-yl]oxyethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2cnc(-c3ccc([N+](=O)[O-])o3)nc2)cc1 |
| InChI | InChI=1S/C17H15N3O7S/c1-12-2-4-14(5-3-12)28(23,24)26-9-8-25-13-10-18-17(19-11-13)15-6-7-16(27-15)20(21)22/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | AMUVIGZHRASSQV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 134.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|