C21H19N7S — CID 154115974
1-[4-(5-pyridin-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenyl]-3-(pyridin-2-ylmethylideneamino)thiourea (PubChem CID 154115974) has the molecular formula C21H19N7S and a molecular weight of 401.50 g/mol. Its IUPAC name is 1-[4-(5-pyridin-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenyl]-3-(pyridin-2-ylmethylideneamino)thiourea.
| Compound Name | 1-[4-(5-pyridin-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenyl]-3-(pyridin-2-ylmethylideneamino)thiourea |
|---|---|
| PubChem CID | 154115974 |
| Molecular Formula | C21H19N7S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1-[4-(5-pyridin-2-yl-4,5-dihydro-1H-pyrazol-3-yl)phenyl]-3-(pyridin-2-ylmethylideneamino)thiourea |
| SMILES | S=C(NN=Cc1ccccn1)Nc1ccc(C2=NNC(c3ccccn3)C2)cc1 |
| InChI | InChI=1S/C21H19N7S/c29-21(28-24-14-17-5-1-3-11-22-17)25-16-9-7-15(8-10-16)19-13-20(27-26-19)18-6-2-4-12-23-18/h1-12,14,20,27H,13H2,(H2,25,28,29) |
| InChIKey | CCLPBBOIGNAYEC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|