C23H30N2O4 — CID 154193849
3-(diethylamino)propyl 4-benzamido-2-ethoxybenzoate (PubChem CID 154193849) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 3-(diethylamino)propyl 4-benzamido-2-ethoxybenzoate.
| Compound Name | 3-(diethylamino)propyl 4-benzamido-2-ethoxybenzoate |
|---|---|
| PubChem CID | 154193849 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3-(diethylamino)propyl 4-benzamido-2-ethoxybenzoate |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)ccc1C(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C23H30N2O4/c1-4-25(5-2)15-10-16-29-23(27)20-14-13-19(17-21(20)28-6-3)24-22(26)18-11-8-7-9-12-18/h7-9,11-14,17H,4-6,10,15-16H2,1-3H3,(H,24,26) |
| InChIKey | FDJPSQGAFKEKMI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|