C6H4F4NO3S- — CID 154233643
1-fluoro-5-(trifluoromethyl)-2H-pyridine-2-sulfonate (PubChem CID 154233643) has the molecular formula C6H4F4NO3S- and a molecular weight of 246.16 g/mol. Its IUPAC name is 1-fluoro-5-(trifluoromethyl)-2H-pyridine-2-sulfonate.
| Compound Name | 1-fluoro-5-(trifluoromethyl)-2H-pyridine-2-sulfonate |
|---|---|
| PubChem CID | 154233643 |
| Molecular Formula | C6H4F4NO3S- |
| Molecular Weight | 246.16 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 1-fluoro-5-(trifluoromethyl)-2H-pyridine-2-sulfonate |
| SMILES | O=S(=O)([O-])C1C=CC(C(F)(F)F)=CN1F |
| InChI | InChI=1S/C6H5F4NO3S/c7-6(8,9)4-1-2-5(11(10)3-4)15(12,13)14/h1-3,5H,(H,12,13,14)/p-1 |
| InChIKey | OKGFYTHJCGAWHU-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|