C10H6N2O2S — CID 154317074
3-oxo-1H-[1,3]thiazolo[4,5-g]quinolin-2-one (PubChem CID 154317074) has the molecular formula C10H6N2O2S and a molecular weight of 218.24 g/mol. Its IUPAC name is 3-oxo-1H-[1,3]thiazolo[4,5-g]quinolin-2-one.
| Compound Name | 3-oxo-1H-[1,3]thiazolo[4,5-g]quinolin-2-one |
|---|---|
| PubChem CID | 154317074 |
| Molecular Formula | C10H6N2O2S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 3-oxo-1H-[1,3]thiazolo[4,5-g]quinolin-2-one |
| SMILES | O=C1Nc2cc3cccnc3cc2S1=O |
| InChI | InChI=1S/C10H6N2O2S/c13-10-12-8-4-6-2-1-3-11-7(6)5-9(8)15(10)14/h1-5H,(H,12,13) |
| InChIKey | XCAXSWXSCCRDFM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|