C12H5Cl5F14 — CID 154407193
8,9,10,12,12-pentachloro-1,1,2,3,4,4,5,5,6,6,7,7,8,12-tetradecafluorododec-1-ene (PubChem CID 154407193) has the molecular formula C12H5Cl5F14 and a molecular weight of 592.41 g/mol. Its IUPAC name is 8,9,10,12,12-pentachloro-1,1,2,3,4,4,5,5,6,6,7,7,8,12-tetradecafluorododec-1-ene.
| Compound Name | 8,9,10,12,12-pentachloro-1,1,2,3,4,4,5,5,6,6,7,7,8,12-tetradecafluorododec-1-ene |
|---|---|
| PubChem CID | 154407193 |
| Molecular Formula | C12H5Cl5F14 |
| Molecular Weight | 592.41 g/mol |
| Exact Mass | 589.86 |
| IUPAC Name | 8,9,10,12,12-pentachloro-1,1,2,3,4,4,5,5,6,6,7,7,8,12-tetradecafluorododec-1-ene |
| SMILES | FC(F)=C(F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(Cl)C(Cl)C(Cl)CC(F)(Cl)Cl |
| InChI | InChI=1S/C12H5Cl5F14/c13-2(1-7(15,16)22)4(14)8(17,23)10(26,27)12(30,31)11(28,29)9(24,25)5(19)3(18)6(20)21/h2,4-5H,1H2 |
| InChIKey | XFRFGEZYDGTBDQ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.41 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|