C38H54O8SSi — CID 154414472
[2-[9-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-4,8-dimethylnonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 154414472) has the molecular formula C38H54O8SSi and a molecular weight of 699.00 g/mol. Its IUPAC name is [2-[9-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-4,8-dimethylnonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [2-[9-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-4,8-dimethylnonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154414472 |
| Molecular Formula | C38H54O8SSi |
| Molecular Weight | 699.00 g/mol |
| Exact Mass | 698.33 |
| IUPAC Name | [2-[9-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydroxy-4,8-dimethylnonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(CCC(O)C(C)(O)CCCC(C)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OCCO2)cc1 |
| InChI | InChI=1S/C38H54O8SSi/c1-30-19-21-32(22-20-30)47(41,42)45-29-38(43-26-27-44-38)25-23-35(39)37(6,40)24-13-14-31(2)28-46-48(36(3,4)5,33-15-9-7-10-16-33)34-17-11-8-12-18-34/h7-12,15-22,31,35,39-40H,13-14,23-29H2,1-6H3 |
| InChIKey | FSHHFCUKFOJCKC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.00 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|