C34H46O6SSi — CID 134888792
[(2S,4S)-2-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methoxypropyl]-4-methylhex-5-enyl] 4-methylbenzenesulfonate (PubChem CID 134888792) has the molecular formula C34H46O6SSi and a molecular weight of 610.89 g/mol. Its IUPAC name is [(2S,4S)-2-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methoxypropyl]-4-methylhex-5-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,4S)-2-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methoxypropyl]-4-methylhex-5-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134888792 |
| Molecular Formula | C34H46O6SSi |
| Molecular Weight | 610.89 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | [(2S,4S)-2-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methoxypropyl]-4-methylhex-5-enyl] 4-methylbenzenesulfonate |
| SMILES | C=C[C@@H](C)C[C@@H](COS(=O)(=O)c1ccc(C)cc1)[C@@H](O)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC |
| InChI | InChI=1S/C34H46O6SSi/c1-8-26(2)23-28(24-39-41(36,37)29-21-19-27(3)20-22-29)33(35)32(38-7)25-40-42(34(4,5)6,30-15-11-9-12-16-30)31-17-13-10-14-18-31/h8-22,26,28,32-33,35H,1,23-25H2,2-7H3/t26-,28+,32-,33-/m1/s1 |
| InChIKey | IAFDRLSQSJSVDU-PJNNDAMTSA-N |
| XLogP | 5.48 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.89 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|